C12H17N3O2S — CID 64557119
N-(4-acetyl-1,3-thiazol-2-yl)-4-methylpiperidine-4-carboxamide (PubChem CID 64557119) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-4-methylpiperidine-4-carboxamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-4-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 64557119 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-4-methylpiperidine-4-carboxamide |
| SMILES | CC(=O)c1csc(NC(=O)C2(C)CCNCC2)n1 |
| InChI | InChI=1S/C12H17N3O2S/c1-8(16)9-7-18-11(14-9)15-10(17)12(2)3-5-13-6-4-12/h7,13H,3-6H2,1-2H3,(H,14,15,17) |
| InChIKey | LBXATBHPPPQAHO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |