C13H19N3O2S — CID 64556117
N-(4-acetyl-1,3-thiazol-2-yl)-3-ethylpiperidine-3-carboxamide (PubChem CID 64556117) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)-3-ethylpiperidine-3-carboxamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-ethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 64556117 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)-3-ethylpiperidine-3-carboxamide |
| SMILES | CCC1(C(=O)Nc2nc(C(C)=O)cs2)CCCNC1 |
| InChI | InChI=1S/C13H19N3O2S/c1-3-13(5-4-6-14-8-13)11(18)16-12-15-10(7-19-12)9(2)17/h7,14H,3-6,8H2,1-2H3,(H,15,16,18) |
| InChIKey | KDHSWPCSBXIUSS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |