C15H18ClN3OS — CID 63132685
N-(6-chloro-1,3-benzothiazol-2-yl)-3-ethylpiperidine-3-carboxamide (PubChem CID 63132685) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-3-ethylpiperidine-3-carboxamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-ethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 63132685 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3-ethylpiperidine-3-carboxamide |
| SMILES | CCC1(C(=O)Nc2nc3ccc(Cl)cc3s2)CCCNC1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-2-15(6-3-7-17-9-15)13(20)19-14-18-11-5-4-10(16)8-12(11)21-14/h4-5,8,17H,2-3,6-7,9H2,1H3,(H,18,19,20) |
| InChIKey | IVQDNZCYSVXERY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |