C9H9Cl2N3O2S — CID 96501826
2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 96501826) has the molecular formula C9H9Cl2N3O2S and a molecular weight of 294.16 g/mol. Its IUPAC name is 2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 96501826 |
| Molecular Formula | C9H9Cl2N3O2S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 2-[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | C[C@@]1(C(=O)Nc2nc(C(N)=O)cs2)CC1(Cl)Cl |
| InChI | InChI=1S/C9H9Cl2N3O2S/c1-8(3-9(8,10)11)6(16)14-7-13-4(2-17-7)5(12)15/h2H,3H2,1H3,(H2,12,15)(H,13,14,16)/t8-/m0/s1 |
| InChIKey | ZWDIMAMCVXGZDD-QMMMGPOBSA-N |
| XLogP | 1.76 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|