C13H19N3O3S — CID 80569352
ethyl 2-[[4-(cyclopropylamino)-4-oxobutyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 80569352) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl 2-[[4-(cyclopropylamino)-4-oxobutyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[4-(cyclopropylamino)-4-oxobutyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 80569352 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 2-[[4-(cyclopropylamino)-4-oxobutyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NCCCC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C13H19N3O3S/c1-2-19-12(18)10-8-20-13(16-10)14-7-3-4-11(17)15-9-5-6-9/h8-9H,2-7H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | PVQSPJOXAZEPDL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|