C10H6ClFN2O2S — CID 80570730
2-(2-chloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80570730) has the molecular formula C10H6ClFN2O2S and a molecular weight of 272.69 g/mol. Its IUPAC name is 2-(2-chloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-chloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80570730 |
| Molecular Formula | C10H6ClFN2O2S |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 2-(2-chloro-4-fluoroanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2ccc(F)cc2Cl)s1 |
| InChI | InChI=1S/C10H6ClFN2O2S/c11-6-3-5(12)1-2-7(6)14-10-13-4-8(17-10)9(15)16/h1-4H,(H,13,14)(H,15,16) |
| InChIKey | QEIZOKVBBLWQLU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |