4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid

C15H20N2O3 — CID 80573426

IUPAC4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)CC1CNc2ccccc21
InChIInChI=1S/C15H20N2O3/c1-10(6-7-15(19)20)17-14(18)8-11-9-16-13-5-3-2-4-12(11)13/h2-5,10-11,16H,6-9H2,1H3,(H,17,18)(H,19,20)
InChIKeyGOUFGDGORSVTED-UHFFFAOYSA-N
MW276.34 g/mol
LogP1.96
Rot. Bonds6

About 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid

4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid (PubChem CID 80573426) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid.

Molecular Properties

Compound Name4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid
PubChem CID80573426
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Name4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid
SMILESCC(CCC(=O)O)NC(=O)CC1CNc2ccccc21
InChIInChI=1S/C15H20N2O3/c1-10(6-7-15(19)20)17-14(18)8-11-9-16-13-5-3-2-4-12(11)13/h2-5,10-11,16H,6-9H2,1H3,(H,17,18)(H,19,20)
InChIKeyGOUFGDGORSVTED-UHFFFAOYSA-N
XLogP1.96
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 51.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid?
The IUPAC name of 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid (CID 80573426) is 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid.
What is the SMILES notation for 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid?
The canonical SMILES for 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid is CC(CCC(=O)O)NC(=O)CC1CNc2ccccc21.
What is the InChIKey of 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid?
The InChIKey is GOUFGDGORSVTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-10(6-7-15(19)20)17-14(18)8-11-9-16-13-5-3-2-4-12(11)13/h2-5,10-11,16H,6-9H2,1H3,(H,17,18)(H,19,20).
What are the key properties of 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid?
4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid has a molecular weight of 276.34 g/mol, XLogP of 1.96, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2,3-dihydro-1H-indol-3-yl)acetyl]amino]pentanoic acid is sourced from PubChem (CID 80573426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).