C10H10N4O2S — CID 80575367
methyl 2-[2-[bis(cyanomethyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 80575367) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is methyl 2-[2-[bis(cyanomethyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[bis(cyanomethyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80575367 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | methyl 2-[2-[bis(cyanomethyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(N(CC#N)CC#N)n1 |
| InChI | InChI=1S/C10H10N4O2S/c1-16-9(15)6-8-7-17-10(13-8)14(4-2-11)5-3-12/h7H,4-6H2,1H3 |
| InChIKey | BUCWTGZCZKLFOY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|