C13H18BrClN2O2S2 — CID 80577585
N-(8-azabicyclo[3.2.1]octan-3-yl)-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide (PubChem CID 80577585) has the molecular formula C13H18BrClN2O2S2 and a molecular weight of 413.79 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80577585 |
| Molecular Formula | C13H18BrClN2O2S2 |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-bromo-4-chloro-N-ethylthiophene-2-sulfonamide |
| SMILES | CCN(C1CC2CCC(C1)N2)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C13H18BrClN2O2S2/c1-2-17(10-5-8-3-4-9(6-10)16-8)21(18,19)12-7-11(15)13(14)20-12/h7-10,16H,2-6H2,1H3 |
| InChIKey | FYTWSOCIIODJFA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |