C11H15BrClNO3S2 — CID 80579973
5-bromo-4-chloro-N-methyl-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide (PubChem CID 80579973) has the molecular formula C11H15BrClNO3S2 and a molecular weight of 388.74 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-methyl-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-methyl-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80579973 |
| Molecular Formula | C11H15BrClNO3S2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | 5-bromo-4-chloro-N-methyl-N-(oxan-4-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CN(CC1CCOCC1)S(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C11H15BrClNO3S2/c1-14(7-8-2-4-17-5-3-8)19(15,16)10-6-9(13)11(12)18-10/h6,8H,2-5,7H2,1H3 |
| InChIKey | ALANHDIDLIZWSE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |