C13H14Cl2N2S — CID 80585864
5-chloro-2-(chloromethyl)-1-(thiolan-2-ylmethyl)benzimidazole (PubChem CID 80585864) has the molecular formula C13H14Cl2N2S and a molecular weight of 301.24 g/mol. Its IUPAC name is 5-chloro-2-(chloromethyl)-1-(thiolan-2-ylmethyl)benzimidazole.
| Compound Name | 5-chloro-2-(chloromethyl)-1-(thiolan-2-ylmethyl)benzimidazole |
|---|---|
| PubChem CID | 80585864 |
| Molecular Formula | C13H14Cl2N2S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 5-chloro-2-(chloromethyl)-1-(thiolan-2-ylmethyl)benzimidazole |
| SMILES | ClCc1nc2cc(Cl)ccc2n1CC1CCCS1 |
| InChI | InChI=1S/C13H14Cl2N2S/c14-7-13-16-11-6-9(15)3-4-12(11)17(13)8-10-2-1-5-18-10/h3-4,6,10H,1-2,5,7-8H2 |
| InChIKey | UUDSIFQJCWTWQL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|