C9H17N3O2 — CID 80587776
1-(aminomethyl)-N-[2-(ethylamino)-2-oxoethyl]cyclopropane-1-carboxamide (PubChem CID 80587776) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(aminomethyl)-N-[2-(ethylamino)-2-oxoethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-[2-(ethylamino)-2-oxoethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80587776 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 1-(aminomethyl)-N-[2-(ethylamino)-2-oxoethyl]cyclopropane-1-carboxamide |
| SMILES | CCNC(=O)CNC(=O)C1(CN)CC1 |
| InChI | InChI=1S/C9H17N3O2/c1-2-11-7(13)5-12-8(14)9(6-10)3-4-9/h2-6,10H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | YMOUGIXMWCIUJO-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |