C13H20N2O2S — CID 80589326
1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)cyclobutane-1-carbothioamide (PubChem CID 80589326) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)cyclobutane-1-carbothioamide.
| Compound Name | 1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)cyclobutane-1-carbothioamide |
|---|---|
| PubChem CID | 80589326 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl)cyclobutane-1-carbothioamide |
| SMILES | NC(=S)C1(C(=O)N2CCOC3CCCC32)CCC1 |
| InChI | InChI=1S/C13H20N2O2S/c14-11(18)13(5-2-6-13)12(16)15-7-8-17-10-4-1-3-9(10)15/h9-10H,1-8H2,(H2,14,18) |
| InChIKey | KTGFRSBHRAKLNK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|