C13H19N3OS2 — CID 80591552
1-carbamothioyl-3-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]cyclobutane-1-carboxamide (PubChem CID 80591552) has the molecular formula C13H19N3OS2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 1-carbamothioyl-3-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-3-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80591552 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-carbamothioyl-3-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]cyclobutane-1-carboxamide |
| SMILES | Cc1csc(C(C)NC(=O)C2(C(N)=S)CC(C)C2)n1 |
| InChI | InChI=1S/C13H19N3OS2/c1-7-4-13(5-7,11(14)18)12(17)16-9(3)10-15-8(2)6-19-10/h6-7,9H,4-5H2,1-3H3,(H2,14,18)(H,16,17) |
| InChIKey | WKFSKUNUAWEXGU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|