C15H20OS — CID 80594784
thian-2-yl-(2,4,6-trimethylphenyl)methanone (PubChem CID 80594784) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is thian-2-yl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | thian-2-yl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 80594784 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | thian-2-yl-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)C2CCCCS2)c(C)c1 |
| InChI | InChI=1S/C15H20OS/c1-10-8-11(2)14(12(3)9-10)15(16)13-6-4-5-7-17-13/h8-9,13H,4-7H2,1-3H3 |
| InChIKey | LILZYSIDZXOKBD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |