C12H12Br2OS — CID 114373349
(2,5-dibromophenyl)-(thian-2-yl)methanone (PubChem CID 114373349) has the molecular formula C12H12Br2OS and a molecular weight of 364.10 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(thian-2-yl)methanone.
| Compound Name | (2,5-dibromophenyl)-(thian-2-yl)methanone |
|---|---|
| PubChem CID | 114373349 |
| Molecular Formula | C12H12Br2OS |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | (2,5-dibromophenyl)-(thian-2-yl)methanone |
| SMILES | O=C(c1cc(Br)ccc1Br)C1CCCCS1 |
| InChI | InChI=1S/C12H12Br2OS/c13-8-4-5-10(14)9(7-8)12(15)11-3-1-2-6-16-11/h4-5,7,11H,1-3,6H2 |
| InChIKey | FMODSHGAHZDCBL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |