C11H10Br2OS — CID 114373340
(2,5-dibromophenyl)-(thiolan-2-yl)methanone (PubChem CID 114373340) has the molecular formula C11H10Br2OS and a molecular weight of 350.08 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(thiolan-2-yl)methanone.
| Compound Name | (2,5-dibromophenyl)-(thiolan-2-yl)methanone |
|---|---|
| PubChem CID | 114373340 |
| Molecular Formula | C11H10Br2OS |
| Molecular Weight | 350.08 g/mol |
| Exact Mass | 347.88 |
| IUPAC Name | (2,5-dibromophenyl)-(thiolan-2-yl)methanone |
| SMILES | O=C(c1cc(Br)ccc1Br)C1CCCS1 |
| InChI | InChI=1S/C11H10Br2OS/c12-7-3-4-9(13)8(6-7)11(14)10-2-1-5-15-10/h3-4,6,10H,1-2,5H2 |
| InChIKey | MCDOWXDAULSOIO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.08 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |