C13H15BrN2OS2 — CID 82703584
N-(4-bromo-2-carbamothioylphenyl)thiane-2-carboxamide (PubChem CID 82703584) has the molecular formula C13H15BrN2OS2 and a molecular weight of 359.31 g/mol. Its IUPAC name is N-(4-bromo-2-carbamothioylphenyl)thiane-2-carboxamide.
| Compound Name | N-(4-bromo-2-carbamothioylphenyl)thiane-2-carboxamide |
|---|---|
| PubChem CID | 82703584 |
| Molecular Formula | C13H15BrN2OS2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | N-(4-bromo-2-carbamothioylphenyl)thiane-2-carboxamide |
| SMILES | NC(=S)c1cc(Br)ccc1NC(=O)C1CCCCS1 |
| InChI | InChI=1S/C13H15BrN2OS2/c14-8-4-5-10(9(7-8)12(15)18)16-13(17)11-3-1-2-6-19-11/h4-5,7,11H,1-3,6H2,(H2,15,18)(H,16,17) |
| InChIKey | ZBIVCUPDRIKBIA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|