C12H13ClN2OS2 — CID 114003509
N-(4-carbamothioyl-2-chlorophenyl)thiolane-2-carboxamide (PubChem CID 114003509) has the molecular formula C12H13ClN2OS2 and a molecular weight of 300.84 g/mol. Its IUPAC name is N-(4-carbamothioyl-2-chlorophenyl)thiolane-2-carboxamide.
| Compound Name | N-(4-carbamothioyl-2-chlorophenyl)thiolane-2-carboxamide |
|---|---|
| PubChem CID | 114003509 |
| Molecular Formula | C12H13ClN2OS2 |
| Molecular Weight | 300.84 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | N-(4-carbamothioyl-2-chlorophenyl)thiolane-2-carboxamide |
| SMILES | NC(=S)c1ccc(NC(=O)C2CCCS2)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2OS2/c13-8-6-7(11(14)17)3-4-9(8)15-12(16)10-2-1-5-18-10/h3-4,6,10H,1-2,5H2,(H2,14,17)(H,15,16) |
| InChIKey | YMXPEOFSMBLQGM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.84 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|