C17H27NO2S — CID 80595195
1-(3,4-dimethoxyphenyl)-N-(thian-2-ylmethyl)propan-2-amine (PubChem CID 80595195) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-(thian-2-ylmethyl)propan-2-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-(thian-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 80595195 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-(thian-2-ylmethyl)propan-2-amine |
| SMILES | COc1ccc(CC(C)NCC2CCCCS2)cc1OC |
| InChI | InChI=1S/C17H27NO2S/c1-13(18-12-15-6-4-5-9-21-15)10-14-7-8-16(19-2)17(11-14)20-3/h7-8,11,13,15,18H,4-6,9-10,12H2,1-3H3 |
| InChIKey | JMBPSJQWMUJICZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |