C12H13FN2S — CID 80596390
4-fluoro-2-(thian-2-yl)-1H-benzimidazole (PubChem CID 80596390) has the molecular formula C12H13FN2S and a molecular weight of 236.31 g/mol. Its IUPAC name is 4-fluoro-2-(thian-2-yl)-1H-benzimidazole.
| Compound Name | 4-fluoro-2-(thian-2-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 80596390 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-fluoro-2-(thian-2-yl)-1H-benzimidazole |
| SMILES | Fc1cccc2[nH]c(C3CCCCS3)nc12 |
| InChI | InChI=1S/C12H13FN2S/c13-8-4-3-5-9-11(8)15-12(14-9)10-6-1-2-7-16-10/h3-5,10H,1-2,6-7H2,(H,14,15) |
| InChIKey | NWIJVAPQZRDKCP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |