C15H15FN2O2S — CID 80620344
5-(3-fluorophenyl)-4-hydroxy-2-(thian-2-yl)-1H-pyrimidin-6-one (PubChem CID 80620344) has the molecular formula C15H15FN2O2S and a molecular weight of 306.36 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-hydroxy-2-(thian-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3-fluorophenyl)-4-hydroxy-2-(thian-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80620344 |
| Molecular Formula | C15H15FN2O2S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-(3-fluorophenyl)-4-hydroxy-2-(thian-2-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CCCCS2)nc(O)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H15FN2O2S/c16-10-5-3-4-9(8-10)12-14(19)17-13(18-15(12)20)11-6-1-2-7-21-11/h3-5,8,11H,1-2,6-7H2,(H2,17,18,19,20) |
| InChIKey | YXDPHNYOKQSGPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |