C9H11IN2O2S — CID 80621561
4-hydroxy-5-iodo-2-(thian-2-yl)-1H-pyrimidin-6-one (PubChem CID 80621561) has the molecular formula C9H11IN2O2S and a molecular weight of 338.17 g/mol. Its IUPAC name is 4-hydroxy-5-iodo-2-(thian-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-iodo-2-(thian-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 80621561 |
| Molecular Formula | C9H11IN2O2S |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 4-hydroxy-5-iodo-2-(thian-2-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CCCCS2)nc(O)c1I |
| InChI | InChI=1S/C9H11IN2O2S/c10-6-8(13)11-7(12-9(6)14)5-3-1-2-4-15-5/h5H,1-4H2,(H2,11,12,13,14) |
| InChIKey | DVUYPBADZBALEU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|