C12H19N3S — CID 80596479
5-methyl-2-N-(thian-2-ylmethyl)pyridine-2,3-diamine (PubChem CID 80596479) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 5-methyl-2-N-(thian-2-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 5-methyl-2-N-(thian-2-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 80596479 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 5-methyl-2-N-(thian-2-ylmethyl)pyridine-2,3-diamine |
| SMILES | Cc1cnc(NCC2CCCCS2)c(N)c1 |
| InChI | InChI=1S/C12H19N3S/c1-9-6-11(13)12(14-7-9)15-8-10-4-2-3-5-16-10/h6-7,10H,2-5,8,13H2,1H3,(H,14,15) |
| InChIKey | MXDLJCQRORGBDK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |