C10H16N4S — CID 80595606
4-N-(thian-2-ylmethyl)pyrimidine-4,5-diamine (PubChem CID 80595606) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 4-N-(thian-2-ylmethyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(thian-2-ylmethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 80595606 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 4-N-(thian-2-ylmethyl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1NCC1CCCCS1 |
| InChI | InChI=1S/C10H16N4S/c11-9-6-12-7-14-10(9)13-5-8-3-1-2-4-15-8/h6-8H,1-5,11H2,(H,12,13,14) |
| InChIKey | RSELBCYSRSCPOW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |