C10H17N3S — CID 80596485
N-(1H-imidazol-5-ylmethyl)-1-(thian-2-yl)methanamine (PubChem CID 80596485) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-1-(thian-2-yl)methanamine.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-1-(thian-2-yl)methanamine |
|---|---|
| PubChem CID | 80596485 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-1-(thian-2-yl)methanamine |
| SMILES | c1ncc(CNCC2CCCCS2)[nH]1 |
| InChI | InChI=1S/C10H17N3S/c1-2-4-14-10(3-1)7-11-5-9-6-12-8-13-9/h6,8,10-11H,1-5,7H2,(H,12,13) |
| InChIKey | GTRTZLVGSMONSZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |