C9H18N4O4S — CID 80597060
1-(N'-hydroxycarbamimidoyl)-3-methyl-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide (PubChem CID 80597060) has the molecular formula C9H18N4O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-(N'-hydroxycarbamimidoyl)-3-methyl-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(N'-hydroxycarbamimidoyl)-3-methyl-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80597060 |
| Molecular Formula | C9H18N4O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 1-(N'-hydroxycarbamimidoyl)-3-methyl-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)NCCS(N)(=O)=O)(C(N)=NO)C1 |
| InChI | InChI=1S/C9H18N4O4S/c1-6-4-9(5-6,7(10)13-15)8(14)12-2-3-18(11,16)17/h6,15H,2-5H2,1H3,(H2,10,13)(H,12,14)(H2,11,16,17) |
| InChIKey | AQWTYCPYVYTNFN-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|