C8H16N4O4S — CID 80596985
1-(N'-hydroxycarbamimidoyl)-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide (PubChem CID 80596985) has the molecular formula C8H16N4O4S and a molecular weight of 264.31 g/mol. Its IUPAC name is 1-(N'-hydroxycarbamimidoyl)-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(N'-hydroxycarbamimidoyl)-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80596985 |
| Molecular Formula | C8H16N4O4S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-(N'-hydroxycarbamimidoyl)-N-(2-sulfamoylethyl)cyclobutane-1-carboxamide |
| SMILES | NC(=NO)C1(C(=O)NCCS(N)(=O)=O)CCC1 |
| InChI | InChI=1S/C8H16N4O4S/c9-6(12-14)8(2-1-3-8)7(13)11-4-5-17(10,15)16/h14H,1-5H2,(H2,9,12)(H,11,13)(H2,10,15,16) |
| InChIKey | NJFXQDFTIAOGMI-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|