C13H18BrNOS — CID 80599861
2-bromo-4-[(thian-2-ylmethylamino)methyl]phenol (PubChem CID 80599861) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-bromo-4-[(thian-2-ylmethylamino)methyl]phenol.
| Compound Name | 2-bromo-4-[(thian-2-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 80599861 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-bromo-4-[(thian-2-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccc(CNCC2CCCCS2)cc1Br |
| InChI | InChI=1S/C13H18BrNOS/c14-12-7-10(4-5-13(12)16)8-15-9-11-3-1-2-6-17-11/h4-5,7,11,15-16H,1-3,6,8-9H2 |
| InChIKey | ORFGBUCYQCXYGD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |