C14H18N2S — CID 80600472
3-[(thian-2-ylmethylamino)methyl]benzonitrile (PubChem CID 80600472) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-[(thian-2-ylmethylamino)methyl]benzonitrile.
| Compound Name | 3-[(thian-2-ylmethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 80600472 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-[(thian-2-ylmethylamino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNCC2CCCCS2)c1 |
| InChI | InChI=1S/C14H18N2S/c15-9-12-4-3-5-13(8-12)10-16-11-14-6-1-2-7-17-14/h3-5,8,14,16H,1-2,6-7,10-11H2 |
| InChIKey | FVEPMSJPMNXYQC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |