C14H15F2N — CID 80604679
1,1-difluoro-N-methyl-2-naphthalen-1-ylpropan-2-amine (PubChem CID 80604679) has the molecular formula C14H15F2N and a molecular weight of 235.28 g/mol. Its IUPAC name is 1,1-difluoro-N-methyl-2-naphthalen-1-ylpropan-2-amine.
| Compound Name | 1,1-difluoro-N-methyl-2-naphthalen-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 80604679 |
| Molecular Formula | C14H15F2N |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1,1-difluoro-N-methyl-2-naphthalen-1-ylpropan-2-amine |
| SMILES | CNC(C)(c1cccc2ccccc12)C(F)F |
| InChI | InChI=1S/C14H15F2N/c1-14(17-2,13(15)16)12-9-5-7-10-6-3-4-8-11(10)12/h3-9,13,17H,1-2H3 |
| InChIKey | NGKVAAGSROAFJZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |