C15H15F3 — CID 118544454
1-(1,1,1-trifluoro-2-methylbutan-2-yl)naphthalene (PubChem CID 118544454) has the molecular formula C15H15F3 and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-(1,1,1-trifluoro-2-methylbutan-2-yl)naphthalene.
| Compound Name | 1-(1,1,1-trifluoro-2-methylbutan-2-yl)naphthalene |
|---|---|
| PubChem CID | 118544454 |
| Molecular Formula | C15H15F3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-(1,1,1-trifluoro-2-methylbutan-2-yl)naphthalene |
| SMILES | CCC(C)(c1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C15H15F3/c1-3-14(2,15(16,17)18)13-10-6-8-11-7-4-5-9-12(11)13/h4-10H,3H2,1-2H3 |
| InChIKey | KRVQADDFCAEZPT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |