C14H21F2NO — CID 80604708
2-(2-ethoxyphenyl)-1,1-difluoro-N-propylpropan-2-amine (PubChem CID 80604708) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-1,1-difluoro-N-propylpropan-2-amine.
| Compound Name | 2-(2-ethoxyphenyl)-1,1-difluoro-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 80604708 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-(2-ethoxyphenyl)-1,1-difluoro-N-propylpropan-2-amine |
| SMILES | CCCNC(C)(c1ccccc1OCC)C(F)F |
| InChI | InChI=1S/C14H21F2NO/c1-4-10-17-14(3,13(15)16)11-8-6-7-9-12(11)18-5-2/h6-9,13,17H,4-5,10H2,1-3H3 |
| InChIKey | MIZAOATUELXLRH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |