C9H9F2NO3 — CID 80605364
1,1-difluoro-2-(2-nitrophenyl)propan-2-ol (PubChem CID 80605364) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-nitrophenyl)propan-2-ol.
| Compound Name | 1,1-difluoro-2-(2-nitrophenyl)propan-2-ol |
|---|---|
| PubChem CID | 80605364 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 1,1-difluoro-2-(2-nitrophenyl)propan-2-ol |
| SMILES | CC(O)(c1ccccc1[N+](=O)[O-])C(F)F |
| InChI | InChI=1S/C9H9F2NO3/c1-9(13,8(10)11)6-4-2-3-5-7(6)12(14)15/h2-5,8,13H,1H3 |
| InChIKey | SZSZKEUNAMMUGY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|