C11H14IN5OS — CID 80607926
5-iodo-6-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one (PubChem CID 80607926) has the molecular formula C11H14IN5OS and a molecular weight of 391.24 g/mol. Its IUPAC name is 5-iodo-6-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one.
| Compound Name | 5-iodo-6-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 80607926 |
| Molecular Formula | C11H14IN5OS |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 5-iodo-6-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methyl]pyrimidin-4-one |
| SMILES | CCCNc1nnc(Cn2cnc(C)c(I)c2=O)s1 |
| InChI | InChI=1S/C11H14IN5OS/c1-3-4-13-11-16-15-8(19-11)5-17-6-14-7(2)9(12)10(17)18/h6H,3-5H2,1-2H3,(H,13,16) |
| InChIKey | JYZLMNBTOIHXNL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|