C7H9F4N3OS — CID 80608034
N-methyl-5-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 80608034) has the molecular formula C7H9F4N3OS and a molecular weight of 259.23 g/mol. Its IUPAC name is N-methyl-5-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-methyl-5-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80608034 |
| Molecular Formula | C7H9F4N3OS |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-methyl-5-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(COCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C7H9F4N3OS/c1-12-6-14-13-4(16-6)2-15-3-7(10,11)5(8)9/h5H,2-3H2,1H3,(H,12,14) |
| InChIKey | RVFAUWMXMWMDAK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|