C9H17N3O2S — CID 80608408
N-methyl-5-(2-propan-2-yloxyethoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 80608408) has the molecular formula C9H17N3O2S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-methyl-5-(2-propan-2-yloxyethoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-methyl-5-(2-propan-2-yloxyethoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80608408 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | N-methyl-5-(2-propan-2-yloxyethoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(COCCOC(C)C)s1 |
| InChI | InChI=1S/C9H17N3O2S/c1-7(2)14-5-4-13-6-8-11-12-9(10-3)15-8/h7H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | BJCLYUMNBCGGES-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|