C11H14FN5S — CID 80614477
N-ethyl-3-fluoro-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]aniline (PubChem CID 80614477) has the molecular formula C11H14FN5S and a molecular weight of 267.33 g/mol. Its IUPAC name is N-ethyl-3-fluoro-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]aniline.
| Compound Name | N-ethyl-3-fluoro-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 80614477 |
| Molecular Formula | C11H14FN5S |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-ethyl-3-fluoro-N-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]aniline |
| SMILES | CCN(Cc1nnc(NN)s1)c1cccc(F)c1 |
| InChI | InChI=1S/C11H14FN5S/c1-2-17(9-5-3-4-8(12)6-9)7-10-15-16-11(14-13)18-10/h3-6H,2,7,13H2,1H3,(H,14,16) |
| InChIKey | SYCXZGVMQHRRTO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|