C11H14N4S — CID 78962039
5-[(N-ethylanilino)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 78962039) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 5-[(N-ethylanilino)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(N-ethylanilino)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 78962039 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-[(N-ethylanilino)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCN(Cc1nnc(N)s1)c1ccccc1 |
| InChI | InChI=1S/C11H14N4S/c1-2-15(9-6-4-3-5-7-9)8-10-13-14-11(12)16-10/h3-7H,2,8H2,1H3,(H2,12,14) |
| InChIKey | XFJQBAVGMKIYON-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |