C13H23N5OS — CID 80617943
5-(methylamino)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80617943) has the molecular formula C13H23N5OS and a molecular weight of 297.43 g/mol. Its IUPAC name is 5-(methylamino)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-(methylamino)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80617943 |
| Molecular Formula | C13H23N5OS |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 5-(methylamino)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CNc1nnc(C(=O)NCCCN2CCCCC2C)s1 |
| InChI | InChI=1S/C13H23N5OS/c1-10-6-3-4-8-18(10)9-5-7-15-11(19)12-16-17-13(14-2)20-12/h10H,3-9H2,1-2H3,(H,14,17)(H,15,19) |
| InChIKey | NBPBZPLMZKWMJY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|