C11H13N3O2S — CID 80620950
[5-(3-ethoxyphenoxy)-1,3,4-thiadiazol-2-yl]methanamine (PubChem CID 80620950) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is [5-(3-ethoxyphenoxy)-1,3,4-thiadiazol-2-yl]methanamine.
| Compound Name | [5-(3-ethoxyphenoxy)-1,3,4-thiadiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 80620950 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | [5-(3-ethoxyphenoxy)-1,3,4-thiadiazol-2-yl]methanamine |
| SMILES | CCOc1cccc(Oc2nnc(CN)s2)c1 |
| InChI | InChI=1S/C11H13N3O2S/c1-2-15-8-4-3-5-9(6-8)16-11-14-13-10(7-12)17-11/h3-6H,2,7,12H2,1H3 |
| InChIKey | JTPJXVAFWZCYLR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |