C9H7ClN2O2S — CID 80619716
[5-(3-chlorophenoxy)-1,3,4-thiadiazol-2-yl]methanol (PubChem CID 80619716) has the molecular formula C9H7ClN2O2S and a molecular weight of 242.69 g/mol. Its IUPAC name is [5-(3-chlorophenoxy)-1,3,4-thiadiazol-2-yl]methanol.
| Compound Name | [5-(3-chlorophenoxy)-1,3,4-thiadiazol-2-yl]methanol |
|---|---|
| PubChem CID | 80619716 |
| Molecular Formula | C9H7ClN2O2S |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | [5-(3-chlorophenoxy)-1,3,4-thiadiazol-2-yl]methanol |
| SMILES | OCc1nnc(Oc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C9H7ClN2O2S/c10-6-2-1-3-7(4-6)14-9-12-11-8(5-13)15-9/h1-4,13H,5H2 |
| InChIKey | JGAHOPIHPBYTEW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |