C12H13Cl2N3O2S — CID 80623518
N-[[5-(2,3-dichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 80623518) has the molecular formula C12H13Cl2N3O2S and a molecular weight of 334.23 g/mol. Its IUPAC name is N-[[5-(2,3-dichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(2,3-dichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 80623518 |
| Molecular Formula | C12H13Cl2N3O2S |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | N-[[5-(2,3-dichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnc(Oc2cccc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C12H13Cl2N3O2S/c1-18-6-5-15-7-10-16-17-12(20-10)19-9-4-2-3-8(13)11(9)14/h2-4,15H,5-7H2,1H3 |
| InChIKey | QULBEYYZDCMHLB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|