C11H10Cl3N3OS — CID 80624780
N-[[5-(2,4,5-trichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine (PubChem CID 80624780) has the molecular formula C11H10Cl3N3OS and a molecular weight of 338.65 g/mol. Its IUPAC name is N-[[5-(2,4,5-trichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2,4,5-trichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 80624780 |
| Molecular Formula | C11H10Cl3N3OS |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | N-[[5-(2,4,5-trichlorophenoxy)-1,3,4-thiadiazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1nnc(Oc2cc(Cl)c(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C11H10Cl3N3OS/c1-2-15-5-10-16-17-11(19-10)18-9-4-7(13)6(12)3-8(9)14/h3-4,15H,2,5H2,1H3 |
| InChIKey | QWJBPRSLPXKCLJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|