About (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone
(5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 80625077) has the molecular formula C10H15ClN4OS
and a molecular weight of 274.78 g/mol. Its IUPAC name is (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone |
| PubChem CID | 80625077 |
| Molecular Formula | C10H15ClN4OS |
| Molecular Weight | 274.78 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)c2nnc(Cl)s2)CC1 |
| InChI | InChI=1S/C10H15ClN4OS/c1-7(2)14-3-5-15(6-4-14)9(16)8-12-13-10(11)17-8/h7H,3-6H2,1-2H3 |
| InChIKey | PHYGVMJNHIYJOZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.78 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
The IUPAC name of (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone (CID 80625077) is (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
The canonical SMILES for (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone is CC(C)N1CCN(C(=O)c2nnc(Cl)s2)CC1.
What is the InChIKey of (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
The InChIKey is PHYGVMJNHIYJOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN4OS/c1-7(2)14-3-5-15(6-4-14)9(16)8-12-13-10(11)17-8/h7H,3-6H2,1-2H3.
What are the key properties of (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone?
(5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone has a molecular weight of 274.78 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,3,4-thiadiazol-2-yl)-(4-propan-2-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 80625077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).