C8H12ClN3OS — CID 80625648
5-chloro-N-pentan-3-yl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80625648) has the molecular formula C8H12ClN3OS and a molecular weight of 233.72 g/mol. Its IUPAC name is 5-chloro-N-pentan-3-yl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-pentan-3-yl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80625648 |
| Molecular Formula | C8H12ClN3OS |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 5-chloro-N-pentan-3-yl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCC(CC)NC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C8H12ClN3OS/c1-3-5(4-2)10-6(13)7-11-12-8(9)14-7/h5H,3-4H2,1-2H3,(H,10,13) |
| InChIKey | WCSIXLCXXKURNM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |