C5H5ClN4O2S — CID 80618648
N'-acetyl-5-chloro-1,3,4-thiadiazole-2-carbohydrazide (PubChem CID 80618648) has the molecular formula C5H5ClN4O2S and a molecular weight of 220.64 g/mol. Its IUPAC name is N'-acetyl-5-chloro-1,3,4-thiadiazole-2-carbohydrazide.
| Compound Name | N'-acetyl-5-chloro-1,3,4-thiadiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 80618648 |
| Molecular Formula | C5H5ClN4O2S |
| Molecular Weight | 220.64 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | N'-acetyl-5-chloro-1,3,4-thiadiazole-2-carbohydrazide |
| SMILES | CC(=O)NNC(=O)c1nnc(Cl)s1 |
| InChI | InChI=1S/C5H5ClN4O2S/c1-2(11)7-8-3(12)4-9-10-5(6)13-4/h1H3,(H,7,11)(H,8,12) |
| InChIKey | HUAXJDFEEXMTCL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.64 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|