C13H9ClF2N2O3 — CID 80631960
5-(chloromethyl)-2-(2,5-difluoro-4-nitrophenoxy)-3-methylpyridine (PubChem CID 80631960) has the molecular formula C13H9ClF2N2O3 and a molecular weight of 314.68 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2,5-difluoro-4-nitrophenoxy)-3-methylpyridine.
| Compound Name | 5-(chloromethyl)-2-(2,5-difluoro-4-nitrophenoxy)-3-methylpyridine |
|---|---|
| PubChem CID | 80631960 |
| Molecular Formula | C13H9ClF2N2O3 |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 5-(chloromethyl)-2-(2,5-difluoro-4-nitrophenoxy)-3-methylpyridine |
| SMILES | Cc1cc(CCl)cnc1Oc1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H9ClF2N2O3/c1-7-2-8(5-14)6-17-13(7)21-12-4-9(15)11(18(19)20)3-10(12)16/h2-4,6H,5H2,1H3 |
| InChIKey | PRGXEXDHCXMSFR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|