C14H16N2O2 — CID 80633168
(E)-3-[6-[bis(prop-2-enyl)amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 80633168) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (E)-3-[6-[bis(prop-2-enyl)amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[bis(prop-2-enyl)amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80633168 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (E)-3-[6-[bis(prop-2-enyl)amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | C=CCN(CC=C)c1ccc(/C=C/C(=O)O)cn1 |
| InChI | InChI=1S/C14H16N2O2/c1-3-9-16(10-4-2)13-7-5-12(11-15-13)6-8-14(17)18/h3-8,11H,1-2,9-10H2,(H,17,18)/b8-6+ |
| InChIKey | NEQKPSLQBKVUQE-SOFGYWHQSA-N |
| XLogP | 2.36 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|