C12H13F3N2O2 — CID 80633336
(E)-3-[6-[methyl(3,3,3-trifluoropropyl)amino]-3-pyridinyl]prop-2-enoic acid (PubChem CID 80633336) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is (E)-3-[6-[methyl(3,3,3-trifluoropropyl)amino]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[methyl(3,3,3-trifluoropropyl)amino]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 80633336 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (E)-3-[6-[methyl(3,3,3-trifluoropropyl)amino]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CN(CCC(F)(F)F)c1ccc(/C=C/C(=O)O)cn1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-17(7-6-12(13,14)15)10-4-2-9(8-16-10)3-5-11(18)19/h2-5,8H,6-7H2,1H3,(H,18,19)/b5-3+ |
| InChIKey | FWWFIOIPJUJKPM-HWKANZROSA-N |
| XLogP | 2.57 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|